2-(2,3-dihydro-1H-inden-5-ylsulfanyl)benzoic acid structure
|
Common Name | 2-(2,3-dihydro-1H-inden-5-ylsulfanyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 56096-73-2 | Molecular Weight | 270.34600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2,3-dihydro-1H-inden-5-ylsulfanyl)benzoic acid |
|---|
| Molecular Formula | C16H14O2S |
|---|---|
| Molecular Weight | 270.34600 |
| Exact Mass | 270.07100 |
| PSA | 62.60000 |
| LogP | 4.02470 |
| InChIKey | WUSHAACTPTZUBD-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1Sc1ccc2c(c1)CCC2 |
|
~%
2-(2,3-dihydro-... CAS#:56096-73-2 |
| Literature: Cervena; Svatek; Metysova; Protiva Collection of Czechoslovak Chemical Communications, 1974 , vol. 39, # 12 p. 3733 - 3740 |
|
~%
2-(2,3-dihydro-... CAS#:56096-73-2 |
| Literature: Cervena; Svatek; Metysova; Protiva Collection of Czechoslovak Chemical Communications, 1974 , vol. 39, # 12 p. 3733 - 3740 |