11beta,18,21-Trihydroxypregn-5-ene-3,20-dione
Modify Date: 2025-09-04 22:44:22
11beta,18,21-Trihydroxypregn-5-ene-3,20-dione structure
|
Common Name | 11beta,18,21-Trihydroxypregn-5-ene-3,20-dione | ||
|---|---|---|---|---|
| CAS Number | 561-64-8 | Molecular Weight | 362.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H30O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 11beta,18,21-Trihydroxypregn-5-ene-3,20-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H30O5 |
|---|---|
| Molecular Weight | 362.5 |
| InChIKey | RFHMOZKSOYTRQY-ZVIOFETBSA-N |
| SMILES | CC12CCC(=O)CC1=CCC1C2C(O)CC2(CO)C(C(=O)CO)CCC12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 11beta,18,21-Trihydroxypregn-5-ene-3,20-dione? |
| A: Molecular formula of 11beta,18,21-Trihydroxypregn-5-ene-3,20-dione is C21H30O5. |
| Q: What is the molecular weight of 11beta,18,21-Trihydroxypregn-5-ene-3,20-dione? |
| A: Molecular weight of 11beta,18,21-Trihydroxypregn-5-ene-3,20-dione is 362.5. |
| Q: What is the CAS number of 11beta,18,21-Trihydroxypregn-5-ene-3,20-dione? |
| A: CAS number of 11beta,18,21-Trihydroxypregn-5-ene-3,20-dione is 561-64-8. |
| Q: What is the SMILES notation of 11beta,18,21-Trihydroxypregn-5-ene-3,20-dione? |
| A: SMILES notation of 11beta,18,21-Trihydroxypregn-5-ene-3,20-dione is CC12CCC(=O)CC1=CCC1C2C(O)CC2(CO)C(C(=O)CO)CCC12. |
| Q: What is the English name of 11beta,18,21-Trihydroxypregn-5-ene-3,20-dione? |
| A: The English name of 11beta,18,21-Trihydroxypregn-5-ene-3,20-dione is 11beta,18,21-Trihydroxypregn-5-ene-3,20-dione. |
| Q: What is the Chinese name of 561-64-8? |
| A: Chinese name of 561-64-8 is 561-64-8. |
| Q: What is the InChIKey of 11beta,18,21-Trihydroxypregn-5-ene-3,20-dione? |
| A: InChIKey of 11beta,18,21-Trihydroxypregn-5-ene-3,20-dione is RFHMOZKSOYTRQY-ZVIOFETBSA-N. |