Fesogenin structure
|
Common Name | Fesogenin | ||
|---|---|---|---|---|
| CAS Number | 561-98-8 | Molecular Weight | 412.60500 | |
| Density | 1.14g/cm3 | Boiling Point | 573.8ºC at 760 mmHg | |
| Molecular Formula | C27H40O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 314.8ºC | |
| Name | Fesogenin |
|---|
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 573.8ºC at 760 mmHg |
| Molecular Formula | C27H40O3 |
| Molecular Weight | 412.60500 |
| Flash Point | 314.8ºC |
| Exact Mass | 412.29800 |
| PSA | 57.53000 |
| LogP | 5.07010 |
| Index of Refraction | 1.575 |
| InChIKey | CGZZUMJKIYSDPE-UHFFFAOYSA-N |
| SMILES | CC(CO)CC1=C2CC3C4CC=C5CC(O)CCC5(C)C4CCC3(C)C2C(C)C1=O |
|
~%
Fesogenin CAS#:561-98-8 |
| Literature: Marker; Lopez Journal of the American Chemical Society, 1947 , vol. 69, p. 2373 |
|
~%
Fesogenin CAS#:561-98-8 |
| Literature: Marker et al. Journal of the American Chemical Society, 1947 , vol. 69, p. 2167,2189 |
|
~%
Fesogenin CAS#:561-98-8 |
| Literature: Kaufmann; Rosenkranz Journal of the American Chemical Society, 1948 , vol. 70, p. 3502,3504 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |