Fesogenin
Fesogenin structure
|
Common Name | Fesogenin | ||
|---|---|---|---|---|
| CAS Number | 561-98-8 | Molecular Weight | 412.60500 | |
| Density | 1.14g/cm3 | Boiling Point | 573.8ºC at 760 mmHg | |
| Molecular Formula | C27H40O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 314.8ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Fesogenin |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 573.8ºC at 760 mmHg |
| Molecular Formula | C27H40O3 |
| Molecular Weight | 412.60500 |
| Flash Point | 314.8ºC |
| Exact Mass | 412.29800 |
| PSA | 57.53000 |
| LogP | 5.07010 |
| Index of Refraction | 1.575 |
| InChIKey | CGZZUMJKIYSDPE-UHFFFAOYSA-N |
| SMILES | CC(CO)CC1=C2CC3C4CC=C5CC(O)CCC5(C)C4CCC3(C)C2C(C)C1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Fesogenin CAS#:561-98-8 |
| Literature: Marker; Lopez Journal of the American Chemical Society, 1947 , vol. 69, p. 2373 |
|
~%
Fesogenin CAS#:561-98-8 |
| Literature: Marker et al. Journal of the American Chemical Society, 1947 , vol. 69, p. 2167,2189 |
|
~%
Fesogenin CAS#:561-98-8 |
| Literature: Kaufmann; Rosenkranz Journal of the American Chemical Society, 1948 , vol. 70, p. 3502,3504 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Fesogenin? |
| A: SMILES notation of Fesogenin is CC(CO)CC1=C2CC3C4CC=C5CC(O)CCC5(C)C4CCC3(C)C2C(C)C1=O. |
| Q: What is the polar surface area (PSA) of Fesogenin? |
| A: Polar surface area (PSA) of Fesogenin is 57.53000. |
| Q: What is the English name of Fesogenin? |
| A: The English name of Fesogenin is Fesogenin. |
| Q: What is the molecular weight of Fesogenin? |
| A: Molecular weight of Fesogenin is 412.60500. |
| Q: What is the boiling point of Fesogenin? |
| A: Boiling point of Fesogenin is 573.8ºC at 760 mmHg. |
| Q: What is the molecular formula of Fesogenin? |
| A: Molecular formula of Fesogenin is C27H40O3. |
| Q: What is the LogP of Fesogenin? |
| A: LogP of Fesogenin is 5.07010. |
| Q: What is the CAS number of Fesogenin? |
| A: CAS number of Fesogenin is 561-98-8. |
| Q: What is the InChIKey of Fesogenin? |
| A: InChIKey of Fesogenin is CGZZUMJKIYSDPE-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 561-98-8? |
| A: Chinese name of 561-98-8 is 561-98-8. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |