1,1-dibutyl-3-(4-methylphenyl)urea structure
|
Common Name | 1,1-dibutyl-3-(4-methylphenyl)urea | ||
|---|---|---|---|---|
| CAS Number | 56124-73-3 | Molecular Weight | 262.39000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H26N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1-dibutyl-3-(4-methylphenyl)urea |
|---|
| Molecular Formula | C16H26N2O |
|---|---|
| Molecular Weight | 262.39000 |
| Exact Mass | 262.20500 |
| PSA | 32.34000 |
| LogP | 4.50210 |
| InChIKey | SRAWWSSZOMEQHP-UHFFFAOYSA-N |
| SMILES | CCCCN(CCCC)C(=O)Nc1ccc(C)cc1 |
| HS Code | 2924299090 |
|---|
|
~94%
1,1-dibutyl-3-(... CAS#:56124-73-3 |
| Literature: DeVries, Vern G.; Bloom, Jonathan D.; Dutia, Minu D.; Katocs, Andrew S.; Largis, Elwood E. Journal of Medicinal Chemistry, 1989 , vol. 32, # 10 p. 2318 - 2325 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |