2-[(tert-Butoxycarbonyl)amino]-3-(trifluoromethoxy)benzoic acid structure
|
Common Name | 2-[(tert-Butoxycarbonyl)amino]-3-(trifluoromethoxy)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 561304-40-3 | Molecular Weight | 444.522 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 716.1±60.0 °C at 760 mmHg | |
| Molecular Formula | C27H28N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 386.9±32.9 °C | |
| Name | 2-[(tert-Butoxycarbonyl)amino]-3-(trifluoromethoxy)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 716.1±60.0 °C at 760 mmHg |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.522 |
| Flash Point | 386.9±32.9 °C |
| Exact Mass | 444.204895 |
| PSA | 84.86000 |
| LogP | 4.58 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.587 |
| InChIKey | DYINHAOLKZFJQC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1c(OC(F)(F)F)cccc1C(=O)O |
| HS Code | 2924299090 |
|---|
|
~81%
2-[(tert-Butoxy... CAS#:561304-40-3 |
| Literature: Pfizer Inc Patent: US2010/324043 A1, 2010 ; Location in patent: Page/Page column 73 ; |
|
~%
2-[(tert-Butoxy... CAS#:561304-40-3 |
| Literature: Carter, Percy; Cherney, Robert Patent: US2003/60459 A1, 2003 ; US 20030060459 A1 |
|
~%
2-[(tert-Butoxy... CAS#:561304-40-3 |
| Literature: Leroux, Frederic; Castagnetti, Eva; Schlosser, Manfred Journal of Organic Chemistry, 2003 , vol. 68, # 12 p. 4693 - 4699 |
|
~%
2-[(tert-Butoxy... CAS#:561304-40-3 |
| Literature: Leroux, Frederic; Castagnetti, Eva; Schlosser, Manfred Journal of Organic Chemistry, 2003 , vol. 68, # 12 p. 4693 - 4699 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-(benzylamino)acetic Acid Hydrochloride |
| N-Benzylglycinhydrochlorid |
| (2S)-2-[(N-Benzoyl-L-phenylalanyl)amino]-3-phenylpropyl acetate |
| Benzenepropanamide, N-[(1S)-2-(acetyloxy)-1-(phenylmethyl)ethyl]-α-(benzoylamino)-, (αS)- |
| N-Bn-glycine hydrochloride |
| N-benzylglycine HCl |
| Bzl-Gly-OH inverted exclamation mark currencyHCl |
| Bzl-Gly-OH.HCl |
| benzylglycinehydrochloride |
| Benzylaminoacetic acid hydrochloride |
| 2-[benzylamino]acetic acid,chloride |
| N-Boc 2-amino-3-(trifluoromethoxy)benzoic acid |
| Asperglaucide |
| N-Benzylglycine hydrochloride |