trimethylsilyl bicyclo[2.2.1]hept-2-ene-5-carboxylate
Modify Date: 2024-09-26 23:36:33
![trimethylsilyl bicyclo[2.2.1]hept-2-ene-5-carboxylate Structure](https://image.chemsrc.com/caspic/309/56151-01-0.png)
trimethylsilyl bicyclo[2.2.1]hept-2-ene-5-carboxylate structure
|
Common Name | trimethylsilyl bicyclo[2.2.1]hept-2-ene-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 56151-01-0 | Molecular Weight | 210.34500 | |
| Density | 1.026g/cm3 | Boiling Point | 233.1ºC at 760 mmHg | |
| Molecular Formula | C11H18O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 78.9ºC | |
| Name | trimethylsilyl bicyclo[2.2.1]hept-2-ene-5-carboxylate |
|---|
| Density | 1.026g/cm3 |
|---|---|
| Boiling Point | 233.1ºC at 760 mmHg |
| Molecular Formula | C11H18O2Si |
| Molecular Weight | 210.34500 |
| Flash Point | 78.9ºC |
| Exact Mass | 210.10800 |
| PSA | 26.30000 |
| LogP | 2.57670 |
| Index of Refraction | 1.486 |
| InChIKey | YDOFALGSXSUFFA-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OC(=O)C1CC2C=CC1C2 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |