Furo[3,2-b]pyridine-2,3-dicarboxylicacid, 6-chloro-, 2,3-dimethyl ester
![Furo[3,2-b]pyridine-2,3-dicarboxylicacid, 6-chloro-, 2,3-dimethyl ester Structure](https://image.chemsrc.com/caspic/038/56159-18-3.png)
Furo[3,2-b]pyridine-2,3-dicarboxylicacid, 6-chloro-, 2,3-dimethyl ester structure
|
Common Name | Furo[3,2-b]pyridine-2,3-dicarboxylicacid, 6-chloro-, 2,3-dimethyl ester | ||
|---|---|---|---|---|
| CAS Number | 56159-18-3 | Molecular Weight | 269.63800 | |
| Density | 1.439g/cm3 | Boiling Point | 332.3ºC at 760mmHg | |
| Molecular Formula | C11H8ClNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.8ºC | |
Summary: Dimethyl 6-chlorofuro[3,2-b]pyridine-2,3-dicarboxylate (English name: dimethyl 6-chlorofuro[3,2-b]pyridine-2,3-dicarboxylate, CAS number: 56159-18-3, molecular formula: C11H8ClNO5, molecular weight: 269.63800), for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | dimethyl 6-chlorofuro[3,2-b]pyridine-2,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.439g/cm3 |
|---|---|
| Boiling Point | 332.3ºC at 760mmHg |
| Molecular Formula | C11H8ClNO5 |
| Molecular Weight | 269.63800 |
| Flash Point | 154.8ºC |
| Exact Mass | 269.00900 |
| PSA | 78.63000 |
| LogP | 2.05440 |
| Index of Refraction | 1.586 |
| InChIKey | FSHAREYYOCEUHL-UHFFFAOYSA-N |
| SMILES | COC(=O)c1oc2cc(Cl)cnc2c1C(=O)OC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Furo[3,2-b]pyri... CAS#:56159-18-3 |
| Literature: Abramovitch,R.A.; Shinkai,I. Journal of the American Chemical Society, 1975 , vol. 97, p. 3227 - 3229 |
|
~%
Furo[3,2-b]pyri... CAS#:56159-18-3 |
| Literature: Abramovitch,R.A.; Shinkai,I. Journal of the American Chemical Society, 1975 , vol. 97, p. 3227 - 3229 |
![7-chloro-furo[3,2-c]pyridine-2,3-dicarboxylic acid dimethyl ester structure](https://image.chemsrc.com/caspic/000/56159-19-4.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 6-chloro-furo[3,2-b]pyridine-2,3-dicarboxylic acid dimethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of dimethyl 6-chlorofuro[3,2-b]pyridine-2,3-dicarboxylate? |
| A: Molecular formula of dimethyl 6-chlorofuro[3,2-b]pyridine-2,3-dicarboxylate is C11H8ClNO5. |
| Q: What is the SMILES notation of dimethyl 6-chlorofuro[3,2-b]pyridine-2,3-dicarboxylate? |
| A: SMILES notation of dimethyl 6-chlorofuro[3,2-b]pyridine-2,3-dicarboxylate is COC(=O)c1oc2cc(Cl)cnc2c1C(=O)OC. |
| Q: What is the English name of dimethyl 6-chlorofuro[3,2-b]pyridine-2,3-dicarboxylate? |
| A: The English name of dimethyl 6-chlorofuro[3,2-b]pyridine-2,3-dicarboxylate is dimethyl 6-chlorofuro[3,2-b]pyridine-2,3-dicarboxylate. |
| Q: What is the Chinese name of 56159-18-3? |
| A: Chinese name of 56159-18-3 is 56159-18-3. |
| Q: What is the molecular weight of dimethyl 6-chlorofuro[3,2-b]pyridine-2,3-dicarboxylate? |
| A: Molecular weight of dimethyl 6-chlorofuro[3,2-b]pyridine-2,3-dicarboxylate is 269.63800. |
| Q: What is the LogP of dimethyl 6-chlorofuro[3,2-b]pyridine-2,3-dicarboxylate? |
| A: LogP of dimethyl 6-chlorofuro[3,2-b]pyridine-2,3-dicarboxylate is 2.05440. |
| Q: What is the InChIKey of dimethyl 6-chlorofuro[3,2-b]pyridine-2,3-dicarboxylate? |
| A: InChIKey of dimethyl 6-chlorofuro[3,2-b]pyridine-2,3-dicarboxylate is FSHAREYYOCEUHL-UHFFFAOYSA-N. |
| Q: What is the boiling point of dimethyl 6-chlorofuro[3,2-b]pyridine-2,3-dicarboxylate? |
| A: Boiling point of dimethyl 6-chlorofuro[3,2-b]pyridine-2,3-dicarboxylate is 332.3ºC at 760mmHg. |
| Q: What are the upstream materials of dimethyl 6-chlorofuro[3,2-b]pyridine-2,3-dicarboxylate? |
| A: Related upstream materials(CAS) of dimethyl 6-chlorofuro[3,2-b]pyridine-2,3-dicarboxylate: 15177-57-8;762-42-5. |
| Q: What is the polar surface area (PSA) of dimethyl 6-chlorofuro[3,2-b]pyridine-2,3-dicarboxylate? |
| A: Polar surface area (PSA) of dimethyl 6-chlorofuro[3,2-b]pyridine-2,3-dicarboxylate is 78.63000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |