1,1,1-trichloro-3-(6-methylpyridin-2-yl)propan-2-ol
Modify Date: 2025-10-04 17:05:00
1,1,1-trichloro-3-(6-methylpyridin-2-yl)propan-2-ol structure
|
Common Name | 1,1,1-trichloro-3-(6-methylpyridin-2-yl)propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 56211-75-7 | Molecular Weight | 254.54100 | |
| Density | 1.411g/cm3 | Boiling Point | 327.9ºC at 760 mmHg | |
| Molecular Formula | C9H10Cl3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.1ºC | |
| Name | 1,1,1-trichloro-3-(6-methylpyridin-2-yl)propan-2-ol |
|---|
| Density | 1.411g/cm3 |
|---|---|
| Boiling Point | 327.9ºC at 760 mmHg |
| Molecular Formula | C9H10Cl3NO |
| Molecular Weight | 254.54100 |
| Flash Point | 152.1ºC |
| Exact Mass | 252.98300 |
| PSA | 33.12000 |
| LogP | 2.66360 |
| Index of Refraction | 1.572 |
| InChIKey | TWTSKQISZZIJSH-UHFFFAOYSA-N |
| SMILES | Cc1cccc(CC(O)C(Cl)(Cl)Cl)n1 |
|
~%
1,1,1-trichloro... CAS#:56211-75-7 |
| Literature: Einhiorn; Gilbody Chemische Berichte, 1893 , vol. 26, p. 1416,1418 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1