Aflatoxin RB2
Modify Date: 2026-08-11 18:13:27
Aflatoxin RB2 structure
|
Common Name | Aflatoxin RB2 | ||
|---|---|---|---|---|
| CAS Number | 56217-84-6 | Molecular Weight | 320.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H20O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Aflatoxin RB2 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H20O6 |
|---|---|
| Molecular Weight | 320.3 |
| InChIKey | AEWYUDFFVRNWHR-ZSGHDVKXSA-N |
| SMILES | COc1cc2c(c(O)c1C1=C(CO)C(O)CC1)C1CCOC1O2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Aflatoxin RB2? |
| A: SMILES notation of Aflatoxin RB2 is COc1cc2c(c(O)c1C1=C(CO)C(O)CC1)C1CCOC1O2. |
| Q: What is the CAS number of Aflatoxin RB2? |
| A: CAS number of Aflatoxin RB2 is 56217-84-6. |
| Q: What is the molecular weight of Aflatoxin RB2? |
| A: Molecular weight of Aflatoxin RB2 is 320.3. |
| Q: What is the InChIKey of Aflatoxin RB2? |
| A: InChIKey of Aflatoxin RB2 is AEWYUDFFVRNWHR-ZSGHDVKXSA-N. |
| Q: What is the molecular formula of Aflatoxin RB2? |
| A: Molecular formula of Aflatoxin RB2 is C17H20O6. |
| Q: What is the English name of Aflatoxin RB2? |
| A: The English name of Aflatoxin RB2 is Aflatoxin RB2. |
| Q: What is the Chinese name of 56217-84-6? |
| A: Chinese name of 56217-84-6 is 56217-84-6. |