acetic acid,hexadec-10-en-1-ol structure
|
Common Name | acetic acid,hexadec-10-en-1-ol | ||
|---|---|---|---|---|
| CAS Number | 56218-70-3 | Molecular Weight | 300.47700 | |
| Density | 0.875g/cm3 | Boiling Point | 348.7ºC at 760 mmHg | |
| Molecular Formula | C18H36O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 88.4ºC | |
| Name | acetic acid,hexadec-10-en-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.875g/cm3 |
|---|---|
| Boiling Point | 348.7ºC at 760 mmHg |
| Molecular Formula | C18H36O3 |
| Molecular Weight | 300.47700 |
| Flash Point | 88.4ºC |
| Exact Mass | 300.26600 |
| PSA | 57.53000 |
| LogP | 5.32690 |
| Index of Refraction | 1.453 |
| InChIKey | BKWAKIYRJHHRFD-NAFXZHHSSA-N |
| SMILES | CC(=O)O.CCCCCC=CCCCCCCCCCO |
|
~%
acetic acid,hex... CAS#:56218-70-3 |
| Literature: Horiike; Tanouchi; Hirano Agricultural and Biological Chemistry, 1980 , vol. 44, # 2 p. 257 - 261 |
|
~%
acetic acid,hex... CAS#:56218-70-3 |
| Literature: Horiike; Tanouchi; Hirano Agricultural and Biological Chemistry, 1980 , vol. 44, # 2 p. 257 - 261 |
|
~%
acetic acid,hex... CAS#:56218-70-3 |
| Literature: Horiike; Tanouchi; Hirano Agricultural and Biological Chemistry, 1980 , vol. 44, # 2 p. 257 - 261 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| hexadec-cis-10-en-1-ol acetate |