4-(2-chloro-4,5-dimethoxy-phenyl)butanoic acid structure
|
Common Name | 4-(2-chloro-4,5-dimethoxy-phenyl)butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 56242-82-1 | Molecular Weight | 258.69800 | |
| Density | 1.232g/cm3 | Boiling Point | 388.3ºC at 760 mmHg | |
| Molecular Formula | C12H15ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.7ºC | |
| Name | 4-(2-chloro-4,5-dimethoxyphenyl)butanoic acid |
|---|
| Density | 1.232g/cm3 |
|---|---|
| Boiling Point | 388.3ºC at 760 mmHg |
| Molecular Formula | C12H15ClO4 |
| Molecular Weight | 258.69800 |
| Flash Point | 188.7ºC |
| Exact Mass | 258.06600 |
| PSA | 55.76000 |
| LogP | 2.76450 |
| Index of Refraction | 1.53 |
| InChIKey | LEDNJNBHUKIFHT-UHFFFAOYSA-N |
| SMILES | COc1cc(Cl)c(CCCC(=O)O)cc1OC |
|
~%
4-(2-chloro-4,5... CAS#:56242-82-1 |
| Literature: Siddiqui Journal of the Indian Chemical Society, 1940 , vol. 17, p. 145 |
|
~10%
4-(2-chloro-4,5... CAS#:56242-82-1 |
| Literature: Trauner, Dirk; Bats, Jan W.; Werner, Andreas; Mulzer, Johann Journal of Organic Chemistry, 1998 , vol. 63, # 17 p. 5908 - 5918 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |