1-tert-butyl-4-[(4-tert-butylphenyl)sulfonylmethylsulfonyl]benzene structure
|
Common Name | 1-tert-butyl-4-[(4-tert-butylphenyl)sulfonylmethylsulfonyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 56255-65-3 | Molecular Weight | 408.57500 | |
| Density | 1.164g/cm3 | Boiling Point | 572.4ºC at 760 mmHg | |
| Molecular Formula | C21H28O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 349.6ºC | |
| Name | 1-tert-butyl-4-[(4-tert-butylphenyl)sulfonylmethylsulfonyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.164g/cm3 |
|---|---|
| Boiling Point | 572.4ºC at 760 mmHg |
| Molecular Formula | C21H28O4S2 |
| Molecular Weight | 408.57500 |
| Flash Point | 349.6ºC |
| Exact Mass | 408.14300 |
| PSA | 85.04000 |
| LogP | 6.64830 |
| Index of Refraction | 1.544 |
| InChIKey | SWOGZDBSWSFUIE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)CS(=O)(=O)c2ccc(C(C)(C)C)cc2)cc1 |
|
~%
1-tert-butyl-4-... CAS#:56255-65-3 |
| Literature: Kenney,W. et al. Journal of the American Chemical Society, 1961 , vol. 83, p. 4019 - 4022 |
| 1,1'-(methanediyldisulfonyl)bis(4-tert-butylbenzene) |
| Bis-<4-tert.-butyl-phenylsulfonyl>-methan |