[5-(2-chlorophenyl)-2H-tetrazol-2-yl]acetic acid structure
|
Common Name | [5-(2-chlorophenyl)-2H-tetrazol-2-yl]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 5626-38-0 | Molecular Weight | 238.63000 | |
| Density | 1.54g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H7ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[5-(2-chlorophenyl)tetrazol-2-yl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.54g/cm3 |
|---|---|
| Molecular Formula | C9H7ClN4O2 |
| Molecular Weight | 238.63000 |
| Exact Mass | 238.02600 |
| PSA | 80.90000 |
| LogP | 1.07810 |
| Index of Refraction | 1.746 |
| InChIKey | XTEQROKRTGIKDV-UHFFFAOYSA-N |
| SMILES | O=C(O)Cn1nnc(-c2ccccc2Cl)n1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-[5-(2-chlorophenyl)-1,2,3,4-tetraazol-2-yl]acetic acid |
| [5-(2-chlorophenyl)-2H-tetrazol-2-yl]acetic acid |
| 2h-tetrazole-2-acetic acid,5-(2-chlorophenyl) |
| [5-(2-Chloro-phenyl)-tetrazol-2-yl]-acetic acid |