p-methoxycinnamic acid, compound with 2,2'-iminodiethanol (1:1) structure
|
Common Name | p-methoxycinnamic acid, compound with 2,2'-iminodiethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 56265-46-4 | Molecular Weight | 283.32000 | |
| Density | N/A | Boiling Point | 342.6ºC at 760mmHg | |
| Molecular Formula | C14H21NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.5ºC | |
| Name | 2-(2-hydroxyethylamino)ethanol,(E)-3-(4-methoxyphenyl)prop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 342.6ºC at 760mmHg |
|---|---|
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32000 |
| Flash Point | 138.5ºC |
| Exact Mass | 283.14200 |
| PSA | 106.43000 |
| InChIKey | YEAYGXLRPMKZBP-KQGICBIGSA-N |
| SMILES | COc1ccc(C=CC(=O)O)cc1.OCCNCCO |
| 3-(4-Methoxyphenyl)-2-propenoic acid compd. with 2,2'-iminobis(ethanol) |
| EINECS 260-082-0 |
| p-Methoxycinnamic acid,compound with 2,2'-iminodiethanol (1:1) |
| DEA-Methoxycinnamate |
| 2-Propenoic acid,3-(4-methoxyphenyl)-,compd. with 2,2'-iminobis(ethanol) (1:1) |
| (E)-3-(4-methoxyphenyl)prop-2-enoic acid |
| Diethanolamine methoxycinnamate |