N-[1-(4-methoxyphenyl)-3-oxo-3-[2-(pyridin-2-ylmethylidene)hydrazinyl]prop-1-en-2-yl]benzamide
![N-[1-(4-methoxyphenyl)-3-oxo-3-[2-(pyridin-2-ylmethylidene)hydrazinyl]prop-1-en-2-yl]benzamide Structure](https://image.chemsrc.com/caspic/424/5628-75-1.png)
N-[1-(4-methoxyphenyl)-3-oxo-3-[2-(pyridin-2-ylmethylidene)hydrazinyl]prop-1-en-2-yl]benzamide structure
|
Common Name | N-[1-(4-methoxyphenyl)-3-oxo-3-[2-(pyridin-2-ylmethylidene)hydrazinyl]prop-1-en-2-yl]benzamide | ||
|---|---|---|---|---|
| CAS Number | 5628-75-1 | Molecular Weight | 400.43000 | |
| Density | 1.19g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C23H20N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[1-(4-methoxyphenyl)-3-oxo-3-[2-(pyridin-2-ylmethylidene)hydrazinyl]prop-1-en-2-yl]benzamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.19g/cm3 |
|---|---|
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.43000 |
| Exact Mass | 400.15400 |
| PSA | 96.17000 |
| LogP | 3.97710 |
| Index of Refraction | 1.606 |
| InChIKey | OZLBFUREMMGDNH-UHFFFAOYSA-N |
| SMILES | COc1ccc(C=C(NC(=O)c2ccccc2)C(=O)NN=Cc2ccccn2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~52%
N-[1-(4-methoxy... CAS#:5628-75-1 |
| Literature: Chauvet, F.; Heumann, A.; Waegell, B. Journal of Organic Chemistry, 1987 , vol. 52, # 10 p. 1916 - 1922 |
![Bicyclo[2.2.1]hept-2-ene,5-methylene structure](https://image.chemsrc.com/caspic/266/694-91-7.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of N-[1-(4-methoxyphenyl)-3-oxo-3-[2-(pyridin-2-ylmethylidene)hydrazinyl]prop-1-en-2-yl]benzamide? |
| A: Polar surface area (PSA) of N-[1-(4-methoxyphenyl)-3-oxo-3-[2-(pyridin-2-ylmethylidene)hydrazinyl]prop-1-en-2-yl]benzamide is 96.17000. |
| Q: What are the upstream materials of N-[1-(4-methoxyphenyl)-3-oxo-3-[2-(pyridin-2-ylmethylidene)hydrazinyl]prop-1-en-2-yl]benzamide? |
| A: Related upstream materials(CAS) of N-[1-(4-methoxyphenyl)-3-oxo-3-[2-(pyridin-2-ylmethylidene)hydrazinyl]prop-1-en-2-yl]benzamide: 694-91-7. |
| Q: What is the English name of N-[1-(4-methoxyphenyl)-3-oxo-3-[2-(pyridin-2-ylmethylidene)hydrazinyl]prop-1-en-2-yl]benzamide? |
| A: The English name of N-[1-(4-methoxyphenyl)-3-oxo-3-[2-(pyridin-2-ylmethylidene)hydrazinyl]prop-1-en-2-yl]benzamide is N-[1-(4-methoxyphenyl)-3-oxo-3-[2-(pyridin-2-ylmethylidene)hydrazinyl]prop-1-en-2-yl]benzamide. |
| Q: What is the InChIKey of N-[1-(4-methoxyphenyl)-3-oxo-3-[2-(pyridin-2-ylmethylidene)hydrazinyl]prop-1-en-2-yl]benzamide? |
| A: InChIKey of N-[1-(4-methoxyphenyl)-3-oxo-3-[2-(pyridin-2-ylmethylidene)hydrazinyl]prop-1-en-2-yl]benzamide is OZLBFUREMMGDNH-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of N-[1-(4-methoxyphenyl)-3-oxo-3-[2-(pyridin-2-ylmethylidene)hydrazinyl]prop-1-en-2-yl]benzamide? |
| A: SMILES notation of N-[1-(4-methoxyphenyl)-3-oxo-3-[2-(pyridin-2-ylmethylidene)hydrazinyl]prop-1-en-2-yl]benzamide is COc1ccc(C=C(NC(=O)c2ccccc2)C(=O)NN=Cc2ccccn2)cc1. |
| Q: What is the molecular formula of N-[1-(4-methoxyphenyl)-3-oxo-3-[2-(pyridin-2-ylmethylidene)hydrazinyl]prop-1-en-2-yl]benzamide? |
| A: Molecular formula of N-[1-(4-methoxyphenyl)-3-oxo-3-[2-(pyridin-2-ylmethylidene)hydrazinyl]prop-1-en-2-yl]benzamide is C23H20N4O3. |
| Q: What is the LogP of N-[1-(4-methoxyphenyl)-3-oxo-3-[2-(pyridin-2-ylmethylidene)hydrazinyl]prop-1-en-2-yl]benzamide? |
| A: LogP of N-[1-(4-methoxyphenyl)-3-oxo-3-[2-(pyridin-2-ylmethylidene)hydrazinyl]prop-1-en-2-yl]benzamide is 3.97710. |
| Q: What is the CAS number of N-[1-(4-methoxyphenyl)-3-oxo-3-[2-(pyridin-2-ylmethylidene)hydrazinyl]prop-1-en-2-yl]benzamide? |
| A: CAS number of N-[1-(4-methoxyphenyl)-3-oxo-3-[2-(pyridin-2-ylmethylidene)hydrazinyl]prop-1-en-2-yl]benzamide is 5628-75-1. |
| Q: What is the molecular weight of N-[1-(4-methoxyphenyl)-3-oxo-3-[2-(pyridin-2-ylmethylidene)hydrazinyl]prop-1-en-2-yl]benzamide? |
| A: Molecular weight of N-[1-(4-methoxyphenyl)-3-oxo-3-[2-(pyridin-2-ylmethylidene)hydrazinyl]prop-1-en-2-yl]benzamide is 400.43000. |
| Q: What is the Chinese name of 5628-75-1? |
| A: Chinese name of 5628-75-1 is 5628-75-1. |