N-[1-(4-methoxyphenyl)-3-oxo-3-[2-(pyridin-2-ylmethylidene)hydrazinyl]prop-1-en-2-yl]benzamide structure
|
Common Name | N-[1-(4-methoxyphenyl)-3-oxo-3-[2-(pyridin-2-ylmethylidene)hydrazinyl]prop-1-en-2-yl]benzamide | ||
|---|---|---|---|---|
| CAS Number | 5628-75-1 | Molecular Weight | 400.43000 | |
| Density | 1.19g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C23H20N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[1-(4-methoxyphenyl)-3-oxo-3-[2-(pyridin-2-ylmethylidene)hydrazinyl]prop-1-en-2-yl]benzamide |
|---|
| Density | 1.19g/cm3 |
|---|---|
| Molecular Formula | C23H20N4O3 |
| Molecular Weight | 400.43000 |
| Exact Mass | 400.15400 |
| PSA | 96.17000 |
| LogP | 3.97710 |
| Index of Refraction | 1.606 |
| InChIKey | OZLBFUREMMGDNH-UHFFFAOYSA-N |
| SMILES | COc1ccc(C=C(NC(=O)c2ccccc2)C(=O)NN=Cc2ccccn2)cc1 |
|
~52%
N-[1-(4-methoxy... CAS#:5628-75-1 |
| Literature: Chauvet, F.; Heumann, A.; Waegell, B. Journal of Organic Chemistry, 1987 , vol. 52, # 10 p. 1916 - 1922 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |