3-(4-methoxynaphthalen-1-yl)-3-methyl-isobenzofuran-1-one structure
|
Common Name | 3-(4-methoxynaphthalen-1-yl)-3-methyl-isobenzofuran-1-one | ||
|---|---|---|---|---|
| CAS Number | 56282-17-8 | Molecular Weight | 304.33900 | |
| Density | 1.233g/cm3 | Boiling Point | 507.1ºC at 760 mmHg | |
| Molecular Formula | C20H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.7ºC | |
| Name | 3-(4-methoxynaphthalen-1-yl)-3-methyl-2-benzofuran-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.233g/cm3 |
|---|---|
| Boiling Point | 507.1ºC at 760 mmHg |
| Molecular Formula | C20H16O3 |
| Molecular Weight | 304.33900 |
| Flash Point | 219.7ºC |
| Exact Mass | 304.11000 |
| PSA | 35.53000 |
| LogP | 4.28230 |
| Index of Refraction | 1.641 |
| InChIKey | RHJORMNNSJVMRP-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2(C)OC(=O)c3ccccc32)c2ccccc12 |
| HS Code | 2932209090 |
|---|
|
~%
3-(4-methoxynap... CAS#:56282-17-8 |
| Literature: Smith et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 319,320 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932209090 |
|---|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(4-methoxy-naphthalen-1-yl)-3-methyl-3H-isobenzofuran-1-one |
| 3-(4-Methoxy-[1]naphthyl)-3-methyl-phthalid |
| 3-(4-Methoxy-1-naphthyl)-3-methyl-2-benzofuran-1(3H)-one |
| 3-(4-methoxy-[1]naphthyl)-3-methyl-phthalide |
| 3-Methyl-3-(4-methoxyl-1-naphthyl)phthalid |