2,5-bis(trifluoromethyl)furan structure
|
Common Name | 2,5-bis(trifluoromethyl)furan | ||
|---|---|---|---|---|
| CAS Number | 56286-72-7 | Molecular Weight | 204.07000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H2F6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,5-bis(trifluoromethyl)furan |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H2F6O |
|---|---|
| Molecular Weight | 204.07000 |
| Exact Mass | 204.00100 |
| PSA | 13.14000 |
| LogP | 3.31720 |
| InChIKey | ULGLWGFLVRSWIF-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc(C(F)(F)F)o1 |
| HS Code | 2932190090 |
|---|
|
~54%
2,5-bis(trifluo... CAS#:56286-72-7 |
| Literature: Nishida, Masakazu; Fujii, Shozo; Aoki, Toshiki; Hayakawa, Yoshio; Muramatsu, Hiroshige; Morita, Tomohiko Journal of Fluorine Chemistry, 1990 , vol. 46, # 3 p. 445 - 459 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| PC0432 |
| 2,5-Bis-(trifluormethyl)furan |
| 2,5-bis-trifluoromethyl-furan |