7-Angelylheliotrine
Modify Date: 2025-08-26 18:47:18
7-Angelylheliotrine structure
|
Common Name | 7-Angelylheliotrine | ||
|---|---|---|---|---|
| CAS Number | 56317-17-0 | Molecular Weight | 395.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H33NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-Angelylheliotrine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H33NO6 |
|---|---|
| Molecular Weight | 395.5 |
| InChIKey | VCEBYLMAPKBSMV-DHTFDINKSA-N |
| SMILES | CC=C(C)C(=O)OC1CCN2CC=C(COC(=O)C(O)(C(C)C)C(C)OC)C12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 7-Angelylheliotrine? |
| A: Molecular formula of 7-Angelylheliotrine is C21H33NO6. |
| Q: What is the molecular weight of 7-Angelylheliotrine? |
| A: Molecular weight of 7-Angelylheliotrine is 395.5. |
| Q: What is the CAS number of 7-Angelylheliotrine? |
| A: CAS number of 7-Angelylheliotrine is 56317-17-0. |
| Q: What is the English name of 7-Angelylheliotrine? |
| A: The English name of 7-Angelylheliotrine is 7-Angelylheliotrine. |
| Q: What is the SMILES notation of 7-Angelylheliotrine? |
| A: SMILES notation of 7-Angelylheliotrine is CC=C(C)C(=O)OC1CCN2CC=C(COC(=O)C(O)(C(C)C)C(C)OC)C12. |
| Q: What is the Chinese name of 56317-17-0? |
| A: Chinese name of 56317-17-0 is 56317-17-0. |
| Q: What is the InChIKey of 7-Angelylheliotrine? |
| A: InChIKey of 7-Angelylheliotrine is VCEBYLMAPKBSMV-DHTFDINKSA-N. |