alpha-Quarterthiophene structure
|
Common Name | alpha-Quarterthiophene | ||
|---|---|---|---|---|
| CAS Number | 5632-29-1 | Molecular Weight | 330.51100 | |
| Density | 1.358g/cm3 | Boiling Point | 453.8ºC at 760mmHg | |
| Molecular Formula | C16H10S4 | Melting Point | 211-214ºC(lit.) | |
| MSDS | USA | Flash Point | 172.3ºC | |
| Name | 2-thiophen-2-yl-5-(5-thiophen-2-ylthiophen-2-yl)thiophene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.358g/cm3 |
|---|---|
| Boiling Point | 453.8ºC at 760mmHg |
| Melting Point | 211-214ºC(lit.) |
| Molecular Formula | C16H10S4 |
| Molecular Weight | 330.51100 |
| Flash Point | 172.3ºC |
| Exact Mass | 329.96700 |
| PSA | 112.96000 |
| LogP | 6.93360 |
| Index of Refraction | 1.695 |
| InChIKey | FXEJOIFDICYSSO-UHFFFAOYSA-N |
| SMILES | c1csc(-c2ccc(-c3ccc(-c4cccs4)s3)s2)c1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2934999090 |
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Charge-transfer crystallites as molecular electrical dopants.
Nat. Commun. 6 , 8560, (2015) Ground-state integer charge transfer is commonly regarded as the basic mechanism of molecular electrical doping in both, conjugated polymers and oligomers. Here, we demonstrate that fundamentally diff... |
|
|
Prenatal ethanol exposure alters met-enkephalin expression in brain regions related with reinforcement: possible mechanism for ethanol consumption in offspring.
Behav. Brain Res. 274 , 194-204, (2014) The endogenous opioid system is involved in ethanol reinforcement. Ethanol-induced changes in opioidergic transmission have been extensively studied in adult organisms. However, the impact of ethanol ... |
|
|
Biophysical characterization of the interaction between FAAP20-UBZ4 domain and Rev1-BRCT domain.
FEBS Lett. 589 , 3037-43, (2015) FAAP20 (Fanconi anemia-associated protein 20) is a subunit of the Fanconi anemia (FA) core complex that repairs interstrand cross-links. To understand the molecular basis for the FA core complex-media... |
| 2,2':5',2'':5'',2'''-Quaterthiophene |
| |A-Quarterthienyl |
| MFCD03094036 |
| 2-(thiophen-2-yl)-5-[5-(thiophen-2-yl)thiophen-2-yl]thiophene |