4,5-Dibromo-2-phenyl-1H-imidazole
Modify Date: 2025-09-25 10:14:33
4,5-Dibromo-2-phenyl-1H-imidazole structure
|
Common Name | 4,5-Dibromo-2-phenyl-1H-imidazole | ||
|---|---|---|---|---|
| CAS Number | 56338-00-2 | Molecular Weight | 301.96500 | |
| Density | 1.903g/cm3 | Boiling Point | 451.5ºC at 760 mmHg | |
| Molecular Formula | C9H6Br2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.9ºC | |
| Name | 4,5-Dibromo-2-phenyl-1H-imidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.903g/cm3 |
|---|---|
| Boiling Point | 451.5ºC at 760 mmHg |
| Molecular Formula | C9H6Br2N2 |
| Molecular Weight | 301.96500 |
| Flash Point | 226.9ºC |
| Exact Mass | 299.89000 |
| PSA | 28.68000 |
| LogP | 3.60170 |
| Index of Refraction | 1.662 |
| InChIKey | VOBXKUYQZPXWPJ-UHFFFAOYSA-N |
| SMILES | Brc1nc(-c2ccccc2)[nH]c1Br |
| HS Code | 2933290090 |
|---|
|
~10%
4,5-Dibromo-2-p... CAS#:56338-00-2 |
| Literature: SELEXAGEN THERAPEUTICS, INC.; VERNIER, Jean-Michel; O'CONNOR, Patrick; RIPKA, William; MATTHEWS, David; PINKERTON, Anthony; BOUNAUD, Pierre-Yves; HOPKINS, Stephanie Patent: WO2011/85269 A1, 2011 ; Location in patent: Page/Page column 75 ; WO 2011/085269 A1 |
|
~%
4,5-Dibromo-2-p... CAS#:56338-00-2 |
| Literature: Forsyth; Nimkar; Pyman Journal of the Chemical Society, 1926 , p. 802 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
CAS#:86119-59-7| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 260-119-0 |
| 4,5-Dibrom-2-phenyl-1H-imidazol |
| 4,5-Dibromo-2-phenylimidazole |
| 2-phenyl-4,5-dibromoimidazole |