(R)-Benzyl 2-bromo-3-phenylpropionate structure
|
Common Name | (R)-Benzyl 2-bromo-3-phenylpropionate | ||
|---|---|---|---|---|
| CAS Number | 56348-66-4 | Molecular Weight | 319.19300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (R)-Benzyl 2-bromo-3-phenylpropionate |
|---|
| Molecular Formula | C16H15BrO2 |
|---|---|
| Molecular Weight | 319.19300 |
| Exact Mass | 318.02600 |
| PSA | 26.30000 |
| LogP | 3.73600 |
| InChIKey | BWBNXECUNXRSST-UHFFFAOYSA-N |
| SMILES | O=C(OCc1ccccc1)C(Br)Cc1ccccc1 |
| HS Code | 2916399090 |
|---|
|
~%
(R)-Benzyl 2-br... CAS#:56348-66-4 |
| Literature: Harpp,D.N. et al. Journal of Organic Chemistry, 1975 , vol. 40, p. 3420 - 3427 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |