1,1'-Oxybis(3,4-dichlorobenzene)
1,1'-Oxybis(3,4-dichlorobenzene) structure
|
Common Name | 1,1'-Oxybis(3,4-dichlorobenzene) | ||
|---|---|---|---|---|
| CAS Number | 56348-72-2 | Molecular Weight | 307.98700 | |
| Density | 1.481g/cm3 | Boiling Point | 374.9ºC at 760 mmHg | |
| Molecular Formula | C12H6Cl4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2-dichloro-4-(3,4-dichlorophenoxy)benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.481g/cm3 |
|---|---|
| Boiling Point | 374.9ºC at 760 mmHg |
| Molecular Formula | C12H6Cl4O |
| Molecular Weight | 307.98700 |
| Flash Point | 140.2ºC |
| Exact Mass | 305.91700 |
| PSA | 9.23000 |
| LogP | 6.09250 |
| Index of Refraction | 1.612 |
| InChIKey | DHLVZXZRIZBPKG-UHFFFAOYSA-N |
| SMILES | Clc1ccc(Oc2ccc(Cl)c(Cl)c2)cc1Cl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~51%
1,1'-Oxybis(3,4... CAS#:56348-72-2 |
| Literature: Nevalainen, Tapio; Koistinen, Jaana; Nurmela, Pirjo Environmental Science & Technology, 1994 , vol. 28, # 7 p. 1341 - 1347 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3,3',4,4'-tetrachlorodiphehyl ether |
| 3,3',4,4'-tetrachlorophenyl ether |
| 3,3',4,4'-Tetrachlorobiphenyl ether |
| 3,3',4,4'-PCDE |
| 3,3',4,4'-tetrachlorodiphenylether |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1,2-dichloro-4-(3,4-dichlorophenoxy)benzene? |
| A: Molecular weight of 1,2-dichloro-4-(3,4-dichlorophenoxy)benzene is 307.98700. |
| Q: What is the InChIKey of 1,2-dichloro-4-(3,4-dichlorophenoxy)benzene? |
| A: InChIKey of 1,2-dichloro-4-(3,4-dichlorophenoxy)benzene is DHLVZXZRIZBPKG-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 1,2-dichloro-4-(3,4-dichlorophenoxy)benzene? |
| A: Related upstream materials(CAS) of 1,2-dichloro-4-(3,4-dichlorophenoxy)benzene: 95-77-2;50848-00-5. |
| Q: What is the boiling point of 1,2-dichloro-4-(3,4-dichlorophenoxy)benzene? |
| A: Boiling point of 1,2-dichloro-4-(3,4-dichlorophenoxy)benzene is 374.9ºC at 760 mmHg. |
| Q: What is the English name of 1,2-dichloro-4-(3,4-dichlorophenoxy)benzene? |
| A: The English name of 1,2-dichloro-4-(3,4-dichlorophenoxy)benzene is 1,2-dichloro-4-(3,4-dichlorophenoxy)benzene. |
| Q: What is the LogP of 1,2-dichloro-4-(3,4-dichlorophenoxy)benzene? |
| A: LogP of 1,2-dichloro-4-(3,4-dichlorophenoxy)benzene is 6.09250. |
| Q: What is the CAS number of 1,2-dichloro-4-(3,4-dichlorophenoxy)benzene? |
| A: CAS number of 1,2-dichloro-4-(3,4-dichlorophenoxy)benzene is 56348-72-2. |
| Q: What English synonyms does 1,2-dichloro-4-(3,4-dichlorophenoxy)benzene have? |
| A: English synonyms of 1,2-dichloro-4-(3,4-dichlorophenoxy)benzene: 3,3',4,4'-tetrachlorodiphehyl ether, 3,3',4,4'-tetrachlorophenyl ether, 3,3',4,4'-Tetrachlorobiphenyl ether, 3,3',4,4'-PCDE, 3,3',4,4'-tetrachlorodiphenylether. |
| Q: What is the polar surface area (PSA) of 1,2-dichloro-4-(3,4-dichlorophenoxy)benzene? |
| A: Polar surface area (PSA) of 1,2-dichloro-4-(3,4-dichlorophenoxy)benzene is 9.23000. |
| Q: What is the molecular formula of 1,2-dichloro-4-(3,4-dichlorophenoxy)benzene? |
| A: Molecular formula of 1,2-dichloro-4-(3,4-dichlorophenoxy)benzene is C12H6Cl4O. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |