2,8-dibromophenoxathiine structure
|
Common Name | 2,8-dibromophenoxathiine | ||
|---|---|---|---|---|
| CAS Number | 56348-81-3 | Molecular Weight | 358.04800 | |
| Density | 1.894g/cm3 | Boiling Point | 403.6ºC at 760 mmHg | |
| Molecular Formula | C12H6Br2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.9ºC | |
| Name | 2,8-dibromophenoxathiine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.894g/cm3 |
|---|---|
| Boiling Point | 403.6ºC at 760 mmHg |
| Molecular Formula | C12H6Br2OS |
| Molecular Weight | 358.04800 |
| Flash Point | 197.9ºC |
| Exact Mass | 355.85100 |
| PSA | 34.53000 |
| LogP | 5.46850 |
| Index of Refraction | 1.716 |
| InChIKey | MZLATBKNUQSUGB-UHFFFAOYSA-N |
| SMILES | Brc1ccc2c(c1)Sc1cc(Br)ccc1O2 |
|
~%
2,8-dibromophen... CAS#:56348-81-3 |
| Literature: Suter et al. Journal of the American Chemical Society, 1936 , vol. 58, p. 717,719 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,8-Dibrom-phenoxathiin |
| 2,8-dibromo-phenoxathiine |