6-methoxy-3-methyl-2,9-dioxo-[1,3]thiazolo[5,4-f]quinoline-8-carboxylic acid structure
|
Common Name | 6-methoxy-3-methyl-2,9-dioxo-[1,3]thiazolo[5,4-f]quinoline-8-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 56355-06-7 | Molecular Weight | 306.29400 | |
| Density | 1.69g/cm3 | Boiling Point | 508.2ºC at 760 mmHg | |
| Molecular Formula | C13H10N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.2ºC | |
| Name | 6-methoxy-3-methyl-2,9-dioxo-[1,3]thiazolo[5,4-f]quinoline-8-carboxylic acid |
|---|
| Density | 1.69g/cm3 |
|---|---|
| Boiling Point | 508.2ºC at 760 mmHg |
| Molecular Formula | C13H10N2O5S |
| Molecular Weight | 306.29400 |
| Flash Point | 261.2ºC |
| Exact Mass | 306.03100 |
| PSA | 118.77000 |
| LogP | 0.67150 |
| Index of Refraction | 1.755 |
| InChIKey | TVLXGTGDMJPEHB-UHFFFAOYSA-N |
| SMILES | COn1cc(C(=O)O)c(=O)c2c3sc(=O)n(C)c3ccc21 |
|
~%
6-methoxy-3-met... CAS#:56355-06-7 |
| Literature: Agui,H. et al. Journal of Medicinal Chemistry, 1977 , vol. 20, p. 791 - 796 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |