(2-fluorophenyl) 4-amino-2-hydroxybenzoate structure
|
Common Name | (2-fluorophenyl) 4-amino-2-hydroxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 56356-25-3 | Molecular Weight | 247.22200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10FNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-fluorophenyl) 4-amino-2-hydroxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H10FNO3 |
|---|---|
| Molecular Weight | 247.22200 |
| Exact Mass | 247.06400 |
| PSA | 72.55000 |
| LogP | 2.91390 |
| InChIKey | HCLNLKPDUQPWGY-UHFFFAOYSA-N |
| SMILES | Nc1ccc(C(=O)Oc2ccccc2F)c(O)c1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-fluorophenyl 4-aminosalicylate |