(3-chlorophenyl) 4-amino-2-hydroxybenzoate structure
|
Common Name | (3-chlorophenyl) 4-amino-2-hydroxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 56356-29-7 | Molecular Weight | 263.67600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3-chlorophenyl) 4-amino-2-hydroxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H10ClNO3 |
|---|---|
| Molecular Weight | 263.67600 |
| Exact Mass | 263.03500 |
| PSA | 72.55000 |
| LogP | 3.42820 |
| InChIKey | MPXOEIQTOIVNHR-UHFFFAOYSA-N |
| SMILES | Nc1ccc(C(=O)Oc2cccc(Cl)c2)c(O)c1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-chlorophenyl 4-aminosalicylate |