1,2-bis(tert-butylsulfanyl)propan-1-one structure
|
Common Name | 1,2-bis(tert-butylsulfanyl)propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 56377-56-1 | Molecular Weight | 234.42200 | |
| Density | 0.994g/cm3 | Boiling Point | 282.2ºC at 760 mmHg | |
| Molecular Formula | C11H22OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 101ºC | |
| Name | S-tert-butyl 2-tert-butylsulfanylpropanethioate |
|---|
| Density | 0.994g/cm3 |
|---|---|
| Boiling Point | 282.2ºC at 760 mmHg |
| Molecular Formula | C11H22OS2 |
| Molecular Weight | 234.42200 |
| Flash Point | 101ºC |
| Exact Mass | 234.11100 |
| PSA | 67.67000 |
| LogP | 3.96490 |
| Index of Refraction | 1.496 |
| InChIKey | AMSYNROAUIHITH-UHFFFAOYSA-N |
| SMILES | CC(SC(C)(C)C)C(=O)SC(C)(C)C |
|
~%
1,2-bis(tert-bu... CAS#:56377-56-1 |
| Literature: Dagli,D.J. et al. Journal of Organic Chemistry, 1975 , vol. 40, p. 3173 - 3178 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |