N-(cycloheptylideneamino)-4-methyl-benzenesulfonamide structure
|
Common Name | N-(cycloheptylideneamino)-4-methyl-benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 56382-69-5 | Molecular Weight | 280.38600 | |
| Density | 1.21g/cm3 | Boiling Point | 429ºC at 760 mmHg | |
| Molecular Formula | C14H20N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.3ºC | |
| Name | N-(cycloheptylideneamino)-4-methylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 429ºC at 760 mmHg |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.38600 |
| Flash Point | 213.3ºC |
| Exact Mass | 280.12500 |
| PSA | 66.91000 |
| LogP | 4.45520 |
| Index of Refraction | 1.59 |
| InChIKey | ALDSHQNICOCDHB-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NN=C2CCCCCC2)cc1 |
| HS Code | 2935009090 |
|---|
|
~99%
N-(cycloheptyli... CAS#:56382-69-5 |
| Literature: Penner, Marlin; Rauniyar, Vivek; Kaspar, Ludwig T.; Hall, Dennis G. Journal of the American Chemical Society, 2009 , vol. 131, # 40 p. 14216 - 14217 |
|
~85%
N-(cycloheptyli... CAS#:56382-69-5 |
| Literature: Rosini, Goffredo; Ballini, Roberto; Zanotti, Valerio Synthesis, 1983 , # 2 p. 137 - 139 |
|
~%
N-(cycloheptyli... CAS#:56382-69-5 |
| Literature: Rosini, Goffredo; Ballini, Roberto; Zanotti, Valerio Synthesis, 1983 , # 2 p. 137 - 139 |
|
~%
N-(cycloheptyli... CAS#:56382-69-5 |
| Literature: Rosini, Goffredo; Ballini, Roberto; Zanotti, Valerio Synthesis, 1983 , # 2 p. 137 - 139 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| Cyclopentanon-tosylhydrazon |
| N-tosylcycloheptanylhydrazone |
| cycloheptanone tosylhydrazone |
| cycloheptanone p-tolylsulfonylhydrazone |
| cycloheptanone (toluene-4-sulfonyl)-hydrazone |
| Cycloheptanon-tosylhydrazon |
| n'-cycloheptylidene-4-methylbenzenesulfonohydrazide |