6-Bromo-3-cyano-4-methylcoumarin structure
|
Common Name | 6-Bromo-3-cyano-4-methylcoumarin | ||
|---|---|---|---|---|
| CAS Number | 56394-22-0 | Molecular Weight | 264.07500 | |
| Density | 1.69g/cm3 | Boiling Point | 403.4ºC at 760 mmHg | |
| Molecular Formula | C11H6BrNO2 | Melting Point | 186-190 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 197.8ºC | |
| Name | 6-Bromo-3-cyano-4-methylcoumarin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.69g/cm3 |
|---|---|
| Boiling Point | 403.4ºC at 760 mmHg |
| Melting Point | 186-190 °C(lit.) |
| Molecular Formula | C11H6BrNO2 |
| Molecular Weight | 264.07500 |
| Flash Point | 197.8ºC |
| Exact Mass | 262.95800 |
| PSA | 54.00000 |
| LogP | 2.73558 |
| Index of Refraction | 1.647 |
| InChIKey | NPCFOYALAZMRDI-UHFFFAOYSA-N |
| SMILES | Cc1c(C#N)c(=O)oc2ccc(Br)cc12 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2932209090 |
|
~%
6-Bromo-3-cyano... CAS#:56394-22-0 |
| Literature: Angewandte Chemie - International Edition, , vol. 50, # 22 p. 5157 - 5161 |
| HS Code | 2932209090 |
|---|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD01076359 |
| 6-bromo-4-methyl-2-oxochromene-3-carbonitrile |