2-[(4-chlorophenyl)methyl]butanedioic acid structure
|
Common Name | 2-[(4-chlorophenyl)methyl]butanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 56416-13-8 | Molecular Weight | 242.65600 | |
| Density | 1.399g/cm3 | Boiling Point | 361.4ºC at 760 mmHg | |
| Molecular Formula | C11H11ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.4ºC | |
| Name | 2-[(4-chlorophenyl)methyl]butanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.399g/cm3 |
|---|---|
| Boiling Point | 361.4ºC at 760 mmHg |
| Molecular Formula | C11H11ClO4 |
| Molecular Weight | 242.65600 |
| Flash Point | 172.4ºC |
| Exact Mass | 242.03500 |
| PSA | 74.60000 |
| LogP | 2.05800 |
| Index of Refraction | 1.579 |
| InChIKey | ZUYLPFIRBGKDRV-UHFFFAOYSA-N |
| SMILES | O=C(O)CC(Cc1ccc(Cl)cc1)C(=O)O |
|
~%
2-[(4-chlorophe... CAS#:56416-13-8 |
| Literature: Devlin; Ollis; Thorpe; Wood; Broughton; Warren; Wooldridge; Wright Journal of the Chemical Society. Perkin transactions 1, 1975 , # 9 p. 830 - 841 |
|
~%
2-[(4-chlorophe... CAS#:56416-13-8 |
| Literature: Devlin; Ollis; Thorpe; Wood; Broughton; Warren; Wooldridge; Wright Journal of the Chemical Society. Perkin transactions 1, 1975 , # 9 p. 830 - 841 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-(4-chlorobenzyl)butanedioic acid |
| 2-(4-chlorobenzyl)succinic acid |
| (4-Chlor-benzyl)-bernsteinsaeure |
| p-Chlorbenzylbernsteinsaeure |
| (4-chloro-benzyl)-succinic acid |