2-(Bromomethyl)-1-chloro-3-nitrobenzene structure
|
Common Name | 2-(Bromomethyl)-1-chloro-3-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 56433-01-3 | Molecular Weight | 250.477 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 295.6±25.0 °C at 760 mmHg | |
| Molecular Formula | C7H5BrClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 132.6±23.2 °C | |
| Name | 6-Chloro-2-nitrobenzyl bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 295.6±25.0 °C at 760 mmHg |
| Molecular Formula | C7H5BrClNO2 |
| Molecular Weight | 250.477 |
| Flash Point | 132.6±23.2 °C |
| Exact Mass | 248.919205 |
| PSA | 45.82000 |
| LogP | 3.34 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | MAIVNONTLACJOK-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(Cl)c1CBr |
| HS Code | 2904909090 |
|---|
|
~83%
2-(Bromomethyl)... CAS#:56433-01-3 |
| Literature: PFIZER INC.; CAMERON, Kimberly O'Keefe; KRAUSS, Achim Hans-Peter; LEFKER, Bruce Allen; NAIR, Sajiv Krishnan; PRASANNA, Ganesh; RUI, Eugene Yuanjin Patent: WO2010/116270 A1, 2010 ; Location in patent: Page/Page column 64-65 ; WO 2010/116270 A1 |
|
~%
2-(Bromomethyl)... CAS#:56433-01-3 |
| Literature: EP1227090 A1, ; EP 1227090 A1 |
|
~%
2-(Bromomethyl)... CAS#:56433-01-3 |
| Literature: Helvetica Chimica Acta, , vol. 12, p. 932 |
|
~%
2-(Bromomethyl)... CAS#:56433-01-3 |
| Literature: DE107501 ; |
| Precursor 4 | |
|---|---|
| DownStream 8 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Benzene, 2-(bromomethyl)-1-chloro-3-nitro- |
| 2-(Bromomethyl)-1-chloro-3-nitrobenzene |