2-AMINO-1-(4'-BENZYLOXYPHENYL)ETHANOL
2-AMINO-1-(4'-BENZYLOXYPHENYL)ETHANOL structure
|
Common Name | 2-AMINO-1-(4'-BENZYLOXYPHENYL)ETHANOL | ||
|---|---|---|---|---|
| CAS Number | 56443-72-2 | Molecular Weight | 243.30100 | |
| Density | 1.164g/cm3 | Boiling Point | 434.5ºC at 760 mmHg | |
| Molecular Formula | C15H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.6ºC | |
Summary: 2-AMINO-1-(4'-BENZYLOXYPHENYL)ETHANOL (CAS number: 56443-72-2), molecular formula C15H17NO2, molecular weight 243.30100. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-amino-1-(4-phenylmethoxyphenyl)ethanol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.164g/cm3 |
|---|---|
| Boiling Point | 434.5ºC at 760 mmHg |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.30100 |
| Flash Point | 216.6ºC |
| Exact Mass | 243.12600 |
| PSA | 55.48000 |
| LogP | 2.95800 |
| Index of Refraction | 1.606 |
| InChIKey | YZOUUVUNKGUDSK-UHFFFAOYSA-N |
| SMILES | NCC(O)c1ccc(OCc2ccccc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~75%
2-AMINO-1-(4'-B... CAS#:56443-72-2 |
| Literature: PFIZER LIMITED; PFIZER INC. Patent: WO2004/52372 A1, 2004 ; Location in patent: Page 76-77 ; WO 2004/052372 A1 |
|
~%
2-AMINO-1-(4'-B... CAS#:56443-72-2 |
| Literature: WO2011/23795 A1, ; Page/Page column 28 ; WO 2011/023795 A1 |
|
~%
2-AMINO-1-(4'-B... CAS#:56443-72-2 |
| Literature: WO2011/23795 A1, ; WO 2011/023795 A1 |
|
~60%
2-AMINO-1-(4'-B... CAS#:56443-72-2 |
| Literature: Somanathan; Rivero; Gama, Angeles; Ochoa; Aguirre Synthetic Communications, 1998 , vol. 28, # 11 p. 2043 - 2048 |
|
~%
2-AMINO-1-(4'-B... CAS#:56443-72-2 |
| Literature: Synthetic Communications, , vol. 28, # 11 p. 2043 - 2048 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Amino-1-(4`-benzyloxyphenyl)ethanol |
| 2-(4-Benzyloxyphenyl)-2-hydroxyethanamine |
| 1-[p-(Benzyloxy)phenyl]-2-aminoethanol |
| 2-(4-benzyloxyphenyl)-2-hydroxyethylamine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 2-amino-1-(4-phenylmethoxyphenyl)ethanol? |
| A: Boiling point of 2-amino-1-(4-phenylmethoxyphenyl)ethanol is 434.5ºC at 760 mmHg. |
| Q: What is the SMILES notation of 2-amino-1-(4-phenylmethoxyphenyl)ethanol? |
| A: SMILES notation of 2-amino-1-(4-phenylmethoxyphenyl)ethanol is NCC(O)c1ccc(OCc2ccccc2)cc1. |
| Q: What is the English name of 2-amino-1-(4-phenylmethoxyphenyl)ethanol? |
| A: The English name of 2-amino-1-(4-phenylmethoxyphenyl)ethanol is 2-amino-1-(4-phenylmethoxyphenyl)ethanol. |
| Q: What are the upstream materials of 2-amino-1-(4-phenylmethoxyphenyl)ethanol? |
| A: Related upstream materials(CAS) of 2-amino-1-(4-phenylmethoxyphenyl)ethanol: 58327-40-5;831196-83-9;4254-67-5;4397-53-9. |
| Q: What is the polar surface area (PSA) of 2-amino-1-(4-phenylmethoxyphenyl)ethanol? |
| A: Polar surface area (PSA) of 2-amino-1-(4-phenylmethoxyphenyl)ethanol is 55.48000. |
| Q: What is the molecular formula of 2-amino-1-(4-phenylmethoxyphenyl)ethanol? |
| A: Molecular formula of 2-amino-1-(4-phenylmethoxyphenyl)ethanol is C15H17NO2. |
| Q: What is the molecular weight of 2-amino-1-(4-phenylmethoxyphenyl)ethanol? |
| A: Molecular weight of 2-amino-1-(4-phenylmethoxyphenyl)ethanol is 243.30100. |
| Q: What English synonyms does 2-amino-1-(4-phenylmethoxyphenyl)ethanol have? |
| A: English synonyms of 2-amino-1-(4-phenylmethoxyphenyl)ethanol: 2-Amino-1-(4`-benzyloxyphenyl)ethanol, 2-(4-Benzyloxyphenyl)-2-hydroxyethanamine, 1-[p-(Benzyloxy)phenyl]-2-aminoethanol, 2-(4-benzyloxyphenyl)-2-hydroxyethylamine. |
| Q: What is the CAS number of 2-amino-1-(4-phenylmethoxyphenyl)ethanol? |
| A: CAS number of 2-amino-1-(4-phenylmethoxyphenyl)ethanol is 56443-72-2. |
| Q: What is the InChIKey of 2-amino-1-(4-phenylmethoxyphenyl)ethanol? |
| A: InChIKey of 2-amino-1-(4-phenylmethoxyphenyl)ethanol is YZOUUVUNKGUDSK-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |