1-[4-amino-5-(4-fluorophenyl)-2-methyl-1H-pyrrol-3-yl]ethanone
Modify Date: 2025-09-24 04:19:27
![1-[4-amino-5-(4-fluorophenyl)-2-methyl-1H-pyrrol-3-yl]ethanone Structure](https://image.chemsrc.com/caspic/092/56463-65-1.png)
1-[4-amino-5-(4-fluorophenyl)-2-methyl-1H-pyrrol-3-yl]ethanone structure
|
Common Name | 1-[4-amino-5-(4-fluorophenyl)-2-methyl-1H-pyrrol-3-yl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 56463-65-1 | Molecular Weight | 232.25400 | |
| Density | 1.239g/cm3 | Boiling Point | 409.8ºC at 760 mmHg | |
| Molecular Formula | C13H13FN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.7ºC | |
| Name | 1-[4-amino-5-(4-fluorophenyl)-2-methyl-1H-pyrrol-3-yl]ethanone |
|---|
| Density | 1.239g/cm3 |
|---|---|
| Boiling Point | 409.8ºC at 760 mmHg |
| Molecular Formula | C13H13FN2O |
| Molecular Weight | 232.25400 |
| Flash Point | 201.7ºC |
| Exact Mass | 232.10100 |
| PSA | 58.88000 |
| LogP | 3.49520 |
| Index of Refraction | 1.603 |
| InChIKey | SWLGHYJGPQLDBS-UHFFFAOYSA-N |
| SMILES | CC(=O)c1c(C)[nH]c(-c2ccc(F)cc2)c1N |
| HS Code | 2933990090 |
|---|
|
~%
1-[4-amino-5-(4... CAS#:56463-65-1 |
| Literature: Gruppo Lepetit S.p.A. Patent: US4140696 A1, 1979 ; |
|
~%
1-[4-amino-5-(4... CAS#:56463-65-1 |
| Literature: Tarzia; Panzone; Leali; Burdisso; Schiatti; Selva Farmaco, Edizione Scientifica, 1984 , vol. 39, # 6 p. 538 - 558 |
|
~%
1-[4-amino-5-(4... CAS#:56463-65-1 |
| Literature: Tarzia; Panzone; Leali; Burdisso; Schiatti; Selva Farmaco, Edizione Scientifica, 1984 , vol. 39, # 6 p. 538 - 558 |
|
~%
1-[4-amino-5-(4... CAS#:56463-65-1 |
| Literature: Tarzia; Panzone; Leali; Burdisso; Schiatti; Selva Farmaco, Edizione Scientifica, 1984 , vol. 39, # 6 p. 538 - 558 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |