methyl 2-phenyltetrazole-5-carboxylate structure
|
Common Name | methyl 2-phenyltetrazole-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 56476-92-7 | Molecular Weight | 204.18500 | |
| Density | 1.37g/cm3 | Boiling Point | 360.2ºC at 760 mmHg | |
| Molecular Formula | C9H8N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.7ºC | |
| Name | methyl 2-phenyltetrazole-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 360.2ºC at 760 mmHg |
| Molecular Formula | C9H8N4O2 |
| Molecular Weight | 204.18500 |
| Flash Point | 171.7ºC |
| Exact Mass | 204.06500 |
| PSA | 69.90000 |
| LogP | 0.44890 |
| Index of Refraction | 1.65 |
| InChIKey | VMVQESZETALCAI-UHFFFAOYSA-N |
| SMILES | COC(=O)c1nnn(-c2ccccc2)n1 |
|
~%
methyl 2-phenyl... CAS#:56476-92-7 |
| Literature: Sutherland, Hamish S.; Blaser, Adrian; Kmentova, Iveta; Franzblau, Scott G.; Wan, Baojie; Wang, Yuehong; Ma, Zhenkun; Palmer, Brian D.; Denny, William A.; Thompson, Andrew M. Journal of Medicinal Chemistry, 2010 , vol. 53, # 2 p. 855 - 866 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Phenyl-tetrazol-5-carbonsaeuremethylester |
| 2-Phenyl-2H-tetrazol-5-carbonsaeuremethylester |
| 2-phenyl-2H-tetrazole-5-carboxylic acid methyl ester |