1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-9-one structure
|
Common Name | 1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-9-one | ||
|---|---|---|---|---|
| CAS Number | 56496-90-3 | Molecular Weight | 372.54100 | |
| Density | 1.029g/cm3 | Boiling Point | 457.4ºC at 760mmHg | |
| Molecular Formula | C24H36O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.4ºC | |
| Name | 1-hydroxy-6,6-dimethyl-3-(2-methyloctan-2-yl)-7,8,10,10a-tetrahydro-6aH-benzo[c]chromen-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.029g/cm3 |
|---|---|
| Boiling Point | 457.4ºC at 760mmHg |
| Molecular Formula | C24H36O3 |
| Molecular Weight | 372.54100 |
| Flash Point | 145.4ºC |
| Exact Mass | 372.26600 |
| PSA | 46.53000 |
| LogP | 6.26400 |
| InChIKey | GECBBEABIDMGGL-UHFFFAOYSA-N |
| SMILES | CCCCCCC(C)(C)c1cc(O)c2c(c1)OC(C)(C)C1CCC(=O)CC21 |
|
~%
1-hydroxy-6,6-d... CAS#:56496-90-3 |
| Literature: Eli Lilly and Company Patent: US4278603 A1, 1981 ; |
|
~%
1-hydroxy-6,6-d... CAS#:56496-90-3 |
| Literature: Eli Lilly and Company Patent: US4054582 A1, 1977 ; |
|
~%
1-hydroxy-6,6-d... CAS#:56496-90-3 |
| Literature: Eli Lilly and Company Patent: US4148809 A1, 1979 ; |
|
~%
1-hydroxy-6,6-d... CAS#:56496-90-3 |
| Literature: Eli Lilly and Company Patent: US4148809 A1, 1979 ; |
|
~41%
1-hydroxy-6,6-d... CAS#:56496-90-3 |
| Literature: Marriott, Karla-Sue C.; Huffman, John W.; Wiley, Jenny L.; Martin, Billy R. Bioorganic and Medicinal Chemistry, 2006 , vol. 14, # 7 p. 2386 - 2397 |
|
~%
1-hydroxy-6,6-d... CAS#:56496-90-3 |
| Literature: Eli Lilly and Company Patent: US3968125 A1, 1976 ; |
| Nabilonum |
| DEA No. 7379 |
| Nabilona |
| Nabilone |