5-[(3-bromophenyl)methylidene]-1,3-diazinane-2,4,6-trione structure
|
Common Name | 5-[(3-bromophenyl)methylidene]-1,3-diazinane-2,4,6-trione | ||
|---|---|---|---|---|
| CAS Number | 56504-53-1 | Molecular Weight | 295.08900 | |
| Density | 1.715g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H7BrN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-m-Brombenzyliden-barbitursaeure |
|---|
| Density | 1.715g/cm3 |
|---|---|
| Molecular Formula | C11H7BrN2O3 |
| Molecular Weight | 295.08900 |
| Exact Mass | 293.96400 |
| PSA | 75.27000 |
| LogP | 1.85610 |
| Index of Refraction | 1.665 |
| InChIKey | VRLYMEBBBXWLQN-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)C(=Cc2cccc(Br)c2)C(=O)N1 |
| HS Code | 2933540000 |
|---|
|
~87%
5-[(3-bromophen... CAS#:56504-53-1 |
| Literature: Figueroa-Villar, J. Daniel; Vieira, Andreia A. Journal of Molecular Structure, 2013 , vol. 1034, p. 310 - 317 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933540000 |
|---|---|
| Summary | 2933540000 other derivatives of malonylurea (barbituric acid); salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |