N-Nitrosoglyphosate sodium structure
|
Common Name | N-Nitrosoglyphosate sodium | ||
|---|---|---|---|---|
| CAS Number | 56516-71-3 | Molecular Weight | 220.05300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C3H6N2NaO6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N-Nitrosoglyphosate sodiumN-Nitrosoglyphosate sodium is the nitrosamine degradation product and synthetic impurity of glyphosate herbicide[1]. |
| Name | N-Nitroso-N-(phosphonomethyl)glycine Sodium Salt |
|---|
| Description | N-Nitrosoglyphosate sodium is the nitrosamine degradation product and synthetic impurity of glyphosate herbicide[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C3H6N2NaO6P |
|---|---|
| Molecular Weight | 220.05300 |
| Exact Mass | 219.98600 |
| PSA | 140.14000 |
| InChIKey | ANBNFCKWUZJADZ-UHFFFAOYSA-M |
| SMILES | O=NN(CC(=O)O)CP(=O)([O-])O.[Na+] |