2-[5-(4-Methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetic acid
Modify Date: 2026-06-25 12:43:02
![2-[5-(4-Methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetic acid Structure](https://www.chemsrc.com/extcaspic/153/565166-95-2.png)
2-[5-(4-Methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetic acid structure
|
Common Name | 2-[5-(4-Methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 565166-95-2 | Molecular Weight | 309.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H15NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[5-(4-Methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H15NO2S |
|---|---|
| Molecular Weight | 309.4 |
| InChIKey | HCQYKZYXBSVPCE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(N=C(S2)C3=CC=CC=C3)CC(=O)O |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: USP8 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 8
External Id: USP8 FAST DUB HTS Primary
|
|
Name: Discovery of Small Molecules to Inhibit Human Cytomegalovirus Nuclear Egress
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
Target: HCMV UL50
External Id: HMS1262
|
|
Name: USP17 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 17 like family member 5
External Id: USP17 FAST DUB HTS Primary
|
|
Name: USP7 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 7
External Id: USP7 FAST DUB HTS Primary
|
|
Name: USP28 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 28
External Id: USP28 FAST DUB HTS Primary
|
|
Name: USP10 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 10
External Id: USP10 FAST DUB HTS Primary
|
|
Name: UCHL1 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin C-terminal hydrolase L1
External Id: UCHL1 FAST DUB HTS Primary
|
|
Name: OTUD3 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: OTU deubiquitinase 3
External Id: OTUD3 FAST DUB HTS Primary
|
|
Name: A screen for compounds that inhibit the activity of LtaS in Staphylococcus aureus
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
External Id: HMS979
|
|
Name: USP30 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 30
External Id: USP30 FAST DUB HTS Primary
|
Total 11, Current Page 1 of 2
1
2
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 565166-95-2? |
| A: Chinese name of 565166-95-2 is 565166-95-2. |
| Q: What is the InChIKey of 2-[5-(4-Methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetic acid? |
| A: InChIKey of 2-[5-(4-Methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetic acid is HCQYKZYXBSVPCE-UHFFFAOYSA-N. |
| Q: What is the English name of 2-[5-(4-Methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetic acid? |
| A: The English name of 2-[5-(4-Methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetic acid is 2-[5-(4-Methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetic acid. |
| Q: What is the molecular weight of 2-[5-(4-Methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetic acid? |
| A: Molecular weight of 2-[5-(4-Methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetic acid is 309.4. |
| Q: What is the molecular formula of 2-[5-(4-Methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetic acid? |
| A: Molecular formula of 2-[5-(4-Methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetic acid is C18H15NO2S. |
| Q: What is the SMILES notation of 2-[5-(4-Methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetic acid? |
| A: SMILES notation of 2-[5-(4-Methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetic acid is CC1=CC=C(C=C1)C2=C(N=C(S2)C3=CC=CC=C3)CC(=O)O. |
| Q: What is the CAS number of 2-[5-(4-Methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetic acid? |
| A: CAS number of 2-[5-(4-Methylphenyl)-2-phenyl-1,3-thiazol-4-yl]acetic acid is 565166-95-2. |