N-(N,N-phthaloyl-glycyl)-L-alanine
N-(N,N-phthaloyl-glycyl)-L-alanine structure
|
Common Name | N-(N,N-phthaloyl-glycyl)-L-alanine | ||
|---|---|---|---|---|
| CAS Number | 5652-29-9 | Molecular Weight | 276.24500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: N-(N,N-Phthaloyl-glycyl)-L-alanine, CAS number: 5652-29-9, molecular formula: C13H12N2O5, molecular weight: 276.24500. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(N,N-phthaloyl-glycyl)-L-alanine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H12N2O5 |
|---|---|
| Molecular Weight | 276.24500 |
| Exact Mass | 276.07500 |
| PSA | 103.78000 |
| LogP | 0.20070 |
| InChIKey | JAEGSMAKFFAPOH-ZETCQYMHSA-N |
| SMILES | CC(NC(=O)CN1C(=O)c2ccccc2C1=O)C(=O)O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2925190090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:3695-73-6This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N-(N,N-phthaloyl-glycyl)-L-alanine? |
| A: The English name of N-(N,N-phthaloyl-glycyl)-L-alanine is N-(N,N-phthaloyl-glycyl)-L-alanine. |
| Q: What is the CAS number of N-(N,N-phthaloyl-glycyl)-L-alanine? |
| A: CAS number of N-(N,N-phthaloyl-glycyl)-L-alanine is 5652-29-9. |
| Q: What is the molecular weight of N-(N,N-phthaloyl-glycyl)-L-alanine? |
| A: Molecular weight of N-(N,N-phthaloyl-glycyl)-L-alanine is 276.24500. |
| Q: What is the polar surface area (PSA) of N-(N,N-phthaloyl-glycyl)-L-alanine? |
| A: Polar surface area (PSA) of N-(N,N-phthaloyl-glycyl)-L-alanine is 103.78000. |
| Q: What are the downstream products of N-(N,N-phthaloyl-glycyl)-L-alanine? |
| A: Related downstream products(CAS) of N-(N,N-phthaloyl-glycyl)-L-alanine: 3695-73-6. |
| Q: What is the Chinese name of 5652-29-9? |
| A: Chinese name of 5652-29-9 is 5652-29-9. |
| Q: What is the SMILES notation of N-(N,N-phthaloyl-glycyl)-L-alanine? |
| A: SMILES notation of N-(N,N-phthaloyl-glycyl)-L-alanine is CC(NC(=O)CN1C(=O)c2ccccc2C1=O)C(=O)O. |
| Q: What is the molecular formula of N-(N,N-phthaloyl-glycyl)-L-alanine? |
| A: Molecular formula of N-(N,N-phthaloyl-glycyl)-L-alanine is C13H12N2O5. |
| Q: What is the LogP of N-(N,N-phthaloyl-glycyl)-L-alanine? |
| A: LogP of N-(N,N-phthaloyl-glycyl)-L-alanine is 0.20070. |
| Q: What is the InChIKey of N-(N,N-phthaloyl-glycyl)-L-alanine? |
| A: InChIKey of N-(N,N-phthaloyl-glycyl)-L-alanine is JAEGSMAKFFAPOH-ZETCQYMHSA-N. |