methyl 2-(1-benzylimino-6-methyl-3,4-dihydro-2H-carbazol-9-yl)acetate structure
|
Common Name | methyl 2-(1-benzylimino-6-methyl-3,4-dihydro-2H-carbazol-9-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 5652-57-3 | Molecular Weight | 360.44900 | |
| Density | 1.17g/cm3 | Boiling Point | 533.6ºC at 760 mmHg | |
| Molecular Formula | C23H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 276.5ºC | |
| Name | methyl 2-(1-benzylimino-6-methyl-3,4-dihydro-2H-carbazol-9-yl)acetate |
|---|
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 533.6ºC at 760 mmHg |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.44900 |
| Flash Point | 276.5ºC |
| Exact Mass | 360.18400 |
| PSA | 43.59000 |
| LogP | 4.44830 |
| Index of Refraction | 1.617 |
| InChIKey | JJDKEQQKGSSLRY-UHFFFAOYSA-N |
| SMILES | COC(=O)Cn1c2c(c3cc(C)ccc31)CCCC2=NCc1ccccc1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |