1-(p-Tolyl)-3-adamantanecarboxylic acid structure
|
Common Name | 1-(p-Tolyl)-3-adamantanecarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 56531-69-2 | Molecular Weight | 270.366 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 424.3±24.0 °C at 760 mmHg | |
| Molecular Formula | C18H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.4±17.6 °C | |
| Name | 3-(4-Methylphenyl)adamantane-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 424.3±24.0 °C at 760 mmHg |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.366 |
| Flash Point | 197.4±17.6 °C |
| Exact Mass | 270.161987 |
| PSA | 37.30000 |
| LogP | 4.49 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.615 |
| InChIKey | UWPMIBVQZDSYNA-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C23CC4CC(CC(C(=O)O)(C4)C2)C3)cc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| HS Code | 2916399090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: qHTS screening for TAG (triacylglycerol) accumulators in algae
Source: 11812
Target: N/A
External Id: FATTTLab-Algae-Lipid
|
|
Name: Fluorescence-based counterscreen assay for HCV NS3 helicase inhibitors of a ChemBridg...
Source: 1102
Target: N/A
External Id: 20130627FPNS3INTERFERECB
|
|
Name: Fluorescence polarization based primary biochemical high throughput screening assay o...
Source: 1102
Target: NS3 [Hepatitis C virus]
External Id: 20130624FPNS3DACB
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| 1-(p-Tolyl)-3-adamantanecarboxylic acid |
| 1-(p-tolyl)-3-adamantanecarboxylicaci |
| (1s,3r,5R,7S)-3-(4-Methylphenyl)-1-adamantanecarboxylic acid |
| tricyclo[3.3.1.1~3,7~]decane-1-carboxylic acid,3-(4-methy |