N-[2-[(2-bromo-4,6-dinitrophenyl)azo]-5-(diethylamino)-4-methoxyphenyl]acetamide structure
|
Common Name | N-[2-[(2-bromo-4,6-dinitrophenyl)azo]-5-(diethylamino)-4-methoxyphenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 56548-64-2 | Molecular Weight | 509.31100 | |
| Density | 1.54 | Boiling Point | 700.4ºC at 760mmHg | |
| Molecular Formula | C19H21BrN6O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Disperse Blue 291 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.54 |
|---|---|
| Boiling Point | 700.4ºC at 760mmHg |
| Molecular Formula | C19H21BrN6O6 |
| Molecular Weight | 509.31100 |
| Exact Mass | 508.07100 |
| PSA | 157.93000 |
| LogP | 6.61350 |
| Index of Refraction | 1.638 |
| InChIKey | QRKGKRSGMAWUMO-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1cc(NC(C)=O)c(N=Nc2c(Br)cc([N+](=O)[O-])cc2[N+](=O)[O-])cc1OC |
|
~74%
N-[2-[(2-bromo-... CAS#:56548-64-2 |
| Literature: Watanabe, Tetsushi; Shiozawa, Tatsushi; Takahashi, Yoshifumi; Takahashi, Tomoyuki; Terao, Yoshiyasu; Nukaya, Haruo; Takamura, Takeji; Sawanishi, Hiroyuki; Ohe, Takeshi; Hirayama, Teruhisa; Wakabayashi, Keiji Mutagenesis, 2002 , vol. 17, # 4 p. 293 - 299 |
|
~%
N-[2-[(2-bromo-... CAS#:56548-64-2 |
| Literature: DyStar Textilfarben GmbH and Co. Deutschland KG Patent: EP1188799 A1, 2002 ; Location in patent: Example 5 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Viosperse Blue 5G. |
| Balicron Blue 6G |
| Disperse Navy Blue S-BGF300 |
| Kiwalon Polyester Blue 5G |
| Terenix Navy Blue F3GL |
| Hisperse Navy C-6G |
| Ambicron Blue SEGBL |
| Disperse Navy Blue 5G |