2-(4-methoxyphenoxy)-2-methylpropanamide structure
|
Common Name | 2-(4-methoxyphenoxy)-2-methylpropanamide | ||
|---|---|---|---|---|
| CAS Number | 5658-66-2 | Molecular Weight | 209.24200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-methoxyphenoxy)-2-methylpropanamide |
|---|
| Molecular Formula | C11H15NO3 |
|---|---|
| Molecular Weight | 209.24200 |
| Exact Mass | 209.10500 |
| PSA | 62.54000 |
| LogP | 2.48760 |
| InChIKey | VZFAXUZQFCJDAY-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC(C)(C)C(N)=O)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
2-(4-methoxyphe... CAS#:5658-66-2 |
| Literature: Coutts, Ian G. C.; Southcott, Mark R. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1990 , p. 767 - 771 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |