Propanamide,2-(4-bromophenoxy)-2-methyl- structure
|
Common Name | Propanamide,2-(4-bromophenoxy)-2-methyl- | ||
|---|---|---|---|---|
| CAS Number | 5658-70-8 | Molecular Weight | 258.11200 | |
| Density | 1.434g/cm3 | Boiling Point | 393.6ºC at 760mmHg | |
| Molecular Formula | C10H12BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.8ºC | |
| Name | 2-(4-bromophenoxy)-2-methylpropanamide |
|---|
| Density | 1.434g/cm3 |
|---|---|
| Boiling Point | 393.6ºC at 760mmHg |
| Molecular Formula | C10H12BrNO2 |
| Molecular Weight | 258.11200 |
| Flash Point | 191.8ºC |
| Exact Mass | 257.00500 |
| PSA | 52.32000 |
| LogP | 2.79210 |
| Index of Refraction | 1.558 |
| InChIKey | UFPWOSSFAUAVAQ-UHFFFAOYSA-N |
| SMILES | CC(C)(Oc1ccc(Br)cc1)C(N)=O |
| HS Code | 2924299090 |
|---|
|
~%
Propanamide,2-(... CAS#:5658-70-8 |
| Literature: IRM LLC; NOVARTIS AG; CHATTERJEE, Arnab Kumar; NAGLE, Advait Suresh; PARASELLI, Prasuna; LEONG, Seh Yong; ROLAND, Jason Thomas; MISHRA, Pranab Kumar; YEUNG, Bryan KS; ZOU, Bin Patent: WO2014/78813 A1, 2014 ; Location in patent: Page/Page column 132; 133 ; |
|
~%
Propanamide,2-(... CAS#:5658-70-8 |
| Literature: Joensson Acta Chemica Scandinavica (1947-1973), 1953 , vol. 7, p. 596,599 |
|
~%
Propanamide,2-(... CAS#:5658-70-8 |
| Literature: Joensson Acta Chemica Scandinavica (1947-1973), 1953 , vol. 7, p. 596,599 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |