2-ethyl-3-oxo-N-phenyl-hexanamide structure
|
Common Name | 2-ethyl-3-oxo-N-phenyl-hexanamide | ||
|---|---|---|---|---|
| CAS Number | 5659-19-8 | Molecular Weight | 233.30600 | |
| Density | 1.065g/cm3 | Boiling Point | 407ºC at 760 mmHg | |
| Molecular Formula | C14H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.3ºC | |
| Name | 2-ethyl-3-oxo-N-phenylhexanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.065g/cm3 |
|---|---|
| Boiling Point | 407ºC at 760 mmHg |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.30600 |
| Flash Point | 155.3ºC |
| Exact Mass | 233.14200 |
| PSA | 46.17000 |
| LogP | 3.09350 |
| Index of Refraction | 1.536 |
| InChIKey | XVVQBWPYLLZVOD-UHFFFAOYSA-N |
| SMILES | CCCC(=O)C(CC)C(=O)Nc1ccccc1 |
|
~%
2-ethyl-3-oxo-N... CAS#:5659-19-8 |
| Literature: Sauer Journal of the American Chemical Society, 1947 , vol. 69, p. 2446 Organic Syntheses, 1951 , vol. 31, p. 68 |
| 2-Aethyl-3-oxo-hexansaeure-anilid |
| 3-Oxo-2-aethyl-hexansaeure-phenylamid |
| 2-ethyl-3-oxo-hexanoic acid anilide |