Octanamide, 2-butyl-3-oxo-N-phenyl- structure
|
Common Name | Octanamide, 2-butyl-3-oxo-N-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 5659-20-1 | Molecular Weight | 289.41200 | |
| Density | 1.015g/cm3 | Boiling Point | 454.6ºC at 760mmHg | |
| Molecular Formula | C18H27NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149ºC | |
| Name | 2-butyl-3-oxo-N-phenyloctanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.015g/cm3 |
|---|---|
| Boiling Point | 454.6ºC at 760mmHg |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.41200 |
| Flash Point | 149ºC |
| Exact Mass | 289.20400 |
| PSA | 46.17000 |
| LogP | 4.65390 |
| Index of Refraction | 1.521 |
| InChIKey | QSNMNTAUXLGQKK-UHFFFAOYSA-N |
| SMILES | CCCCCC(=O)C(CCCC)C(=O)Nc1ccccc1 |
|
~%
Octanamide, 2-b... CAS#:5659-20-1 |
| Literature: Sauer Journal of the American Chemical Society, 1947 , vol. 69, p. 2446 Organic Syntheses, 1951 , vol. 31, p. 68 |
|
~%
Octanamide, 2-b... CAS#:5659-20-1 |
| Literature: Bestmann, Hans Juergen; Kumar, Kammlesh Chemische Berichte, 1983 , vol. 116, # 7 p. 2708 - 2710 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Butyl-3-oxo-octansaeure-anilid |
| 2-butyl-3-oxo-octanoic acid anilide |
| Octanamide,2-butyl-3-oxo-N-phenyl |
| 3-Hydroxy-2-butyl-octen-(2)-saeure-(1)-anilid |