2-(6-(Trifluoromethyl)pyridin-3-yl)propan-2-amine structure
|
Common Name | 2-(6-(Trifluoromethyl)pyridin-3-yl)propan-2-amine | ||
|---|---|---|---|---|
| CAS Number | 566158-78-9 | Molecular Weight | 204.19200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11F3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(6-(Trifluoromethyl)pyridin-3-yl)propan-2-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H11F3N2 |
|---|---|
| Molecular Weight | 204.19200 |
| Exact Mass | 204.08700 |
| PSA | 38.91000 |
| LogP | 2.99450 |
| InChIKey | TYJYXZPYQLKPNY-UHFFFAOYSA-N |
| SMILES | CC(C)(N)c1ccc(C(F)(F)F)nc1 |
|
~80%
2-(6-(Trifluoro... CAS#:566158-78-9 |
| Literature: ELI LILLY AND COMPANY Patent: WO2008/70305 A2, 2008 ; Location in patent: Page/Page column 14-15 ; WO 2008/070305 A2 |
|
~77%
2-(6-(Trifluoro... CAS#:566158-78-9 |
| Literature: ELI LILLY AND COMPANY Patent: WO2008/70305 A2, 2008 ; Location in patent: Page/Page column 13-14 ; WO 2008/070305 A2 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 2-[6-(trifluoromethyl)pyridin-3-yl]propan-2-amine |