1-(4-Methanesulfonyl-phenyl)-2-(4-phenyl-piperazin-1-yl)-ethanol; compound with (Z)-but-2-enedioic acid structure
|
Common Name | 1-(4-Methanesulfonyl-phenyl)-2-(4-phenyl-piperazin-1-yl)-ethanol; compound with (Z)-but-2-enedioic acid | ||
|---|---|---|---|---|
| CAS Number | 56621-71-7 | Molecular Weight | 476.54300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H28N2O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-Methanesulfonyl-phenyl)-2-(4-phenyl-piperazin-1-yl)-ethanol; compound with (Z)-but-2-enedioic acid |
|---|
| Molecular Formula | C23H28N2O7S |
|---|---|
| Molecular Weight | 476.54300 |
| Exact Mass | 476.16200 |
| PSA | 143.83000 |
| LogP | 2.74120 |
| InChIKey | PQFPAZXINOCHKB-WLHGVMLRSA-N |
| SMILES | CS(=O)(=O)c1ccc(C(O)CN2CCN(c3ccccc3)CC2)cc1.O=C(O)C=CC(=O)O |