3,4-Bis(p-methoxyphenyl)-3-buten-2-one structure
|
Common Name | 3,4-Bis(p-methoxyphenyl)-3-buten-2-one | ||
|---|---|---|---|---|
| CAS Number | 56622-38-9 | Molecular Weight | 282.33400 | |
| Density | 1.11g/cm3 | Boiling Point | 461.7ºC at 760mmHg | |
| Molecular Formula | C18H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.1ºC | |
| Name | (3E)-3,4-Bis(4-methoxyphenyl)-3-buten-2-one |
|---|
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 461.7ºC at 760mmHg |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.33400 |
| Flash Point | 225.1ºC |
| Exact Mass | 282.12600 |
| PSA | 35.53000 |
| LogP | 3.83340 |
| InChIKey | UFBJXEMRUMHJDW-PDGQHHTCSA-N |
| SMILES | COc1ccc(C=C(C(C)=O)c2ccc(OC)cc2)cc1 |
|
~%
3,4-Bis(p-metho... CAS#:56622-38-9 |
| Literature: Searle and Co. Patent: US2836623 , 1956 ; |
|
~%
3,4-Bis(p-metho... CAS#:56622-38-9 |
| Literature: Searle and Co. Patent: US2836623 , 1956 ; |
|
~%
3,4-Bis(p-metho... CAS#:56622-38-9 |
| Literature: Searle and Co. Patent: US2836623 , 1956 ; |