methyl 3-phenylimino-2-(trifluoromethyl)prop-2-enoate structure
|
Common Name | methyl 3-phenylimino-2-(trifluoromethyl)prop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 56623-10-0 | Molecular Weight | 243.18200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 3-phenylimino-2-(trifluoromethyl)prop-2-enoate |
|---|
| Molecular Formula | C11H8F3NO2 |
|---|---|
| Molecular Weight | 243.18200 |
| Exact Mass | 243.05100 |
| PSA | 38.66000 |
| LogP | 2.64950 |
| InChIKey | KSKVQJWEHYORQQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=C=Nc1ccccc1)C(F)(F)F |
|
~%
methyl 3-phenyl... CAS#:56623-10-0 |
| Literature: Ter-Gabrielyan,E.G. et al. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1975 , vol. 24, p. 1274 - 1276 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1975 , vol. 24, p. 1380 - 1382 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |